Products 1246814-55-0
CAS 1246814-55-0 appears in our catalog under these names: rac Clopidogrel-13C,d3 Hydrogen Sulfate, Clopidogrel-13C,d3 (sulfate). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
Sulfuric acid;trideuterio(113C)methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (CAS 1246814-55-0) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 423.9 g/mol. IUPAC name: sulfuric acid;trideuterio(113C)methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate. InChIKey: FDEODCTUSIWGLK-SPZGMPHYSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | sulfuric acid;trideuterio(113C)methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| InChIKey | FDEODCTUSIWGLK-SPZGMPHYSA-N |
| SMILES | [2H][13C]([2H])([2H])OC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
rac Clopidogrel-13C,d3 Hydrogen Sulfate