CAS 120202-66-6 appears in our catalog under these names: Clopidogrel Sulfate, Clopidogrel Bisulfate, S-(+)-Clopidogrel Hydrogen Sulfate, >95% (HPLC), Clopidogrel Hydrogen Sulphate, Clopidogrel hydrogen sulfate/ 99.57% (existing batch purity). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 10mg, 1g, 50mg, 250mg, 25mg, 100mg, 200mg.
Methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid (CAS 120202-66-6) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 419.9 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid. InChIKey: FDEODCTUSIWGLK-RSAXXLAASA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChIKey | FDEODCTUSIWGLK-RSAXXLAASA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)