Products 2468372-74-7
CAS 2468372-74-7 appears in our catalog under these names: (Rac)–Clopidogrel–d3 sulfate, (Rac)-Clopidogrel-d3 (sulfate). Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg.
Sulfuric acid;trideuteriomethyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (CAS 2468372-74-7) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 422.9 g/mol. IUPAC name: sulfuric acid;trideuteriomethyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate. InChIKey: FDEODCTUSIWGLK-NIIDSAIPSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 422.9 g/mol |
| IUPAC name | sulfuric acid;trideuteriomethyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| InChIKey | FDEODCTUSIWGLK-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)