cas: 37763-23-8 — see every product listed under this CAS number, including other names
(R)-Methyl 2-amino-2-(4-hydroxyphenyl)acetate, 97%, 97% (CAS 37763-23-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8FT-10g |
| cas | 37763-23-8 |
| size | 10g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 456.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate (CAS 37763-23-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate. InChIKey: SZBDOFWNZVHVGR-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate |
| InChIKey | SZBDOFWNZVHVGR-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)