Products 3079-53-6
CAS 3079-53-6 appears in our catalog under these names: 1-Nitro-2-propoxybenzene, 95%, 1-Nitro-2-propoxybenzene, 95-<97%, 1-Nitro-2-propoxybenzene, 95+%, 1-Nitro-2-propoxybenzene, 1-Nitro-2-propoxybenzene, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 200g.
1-nitro-2-propoxybenzene (CAS 3079-53-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-nitro-2-propoxybenzene. InChIKey: IGIBTRWOXSIMMM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-nitro-2-propoxybenzene |
| InChIKey | IGIBTRWOXSIMMM-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)