CAS 677762-07-1 appears in our catalog under these names: 6-Oxo-1-(propan-2-yl)-1,6-dihydropyridine-3-carboxylic acid, 95%, 1-Isopropyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
6-oxo-1-propan-2-ylpyridine-3-carboxylic acid (CAS 677762-07-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 6-oxo-1-propan-2-ylpyridine-3-carboxylic acid. InChIKey: RYMXPZKXWWLTSB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 6-oxo-1-propan-2-ylpyridine-3-carboxylic acid |
| InChIKey | RYMXPZKXWWLTSB-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C=CC1=O)C(=O)O |
Computed by PubChem (NCBI)