CAS 223127-05-7 appears in our catalog under these names: 6-Isopropoxynicotinic acid, 95%, 6–Isopropoxynicotinic acid, 6-Isopropoxynicotinic acid, 6-Isopropoxynicotinic acid 96%, 6-Isopropoxynicotinic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 500mg, 2,5g, 100mg, 25mg.
6-propan-2-yloxypyridine-3-carboxylic acid (CAS 223127-05-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 6-propan-2-yloxypyridine-3-carboxylic acid. InChIKey: OOIMOWCIYNEWCF-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 6-propan-2-yloxypyridine-3-carboxylic acid |
| InChIKey | OOIMOWCIYNEWCF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)