Products 861315-62-0
CAS 861315-62-0 appears in our catalog under these names: 3-Amino-4-hydroxy-5-methyl-benzoic acid methyl ester, 95%, Methyl 3-amino-4-hydroxy-5-methylbenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
Methyl 3-amino-4-hydroxy-5-methylbenzoate (CAS 861315-62-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 3-amino-4-hydroxy-5-methylbenzoate. InChIKey: JXUSYVMEOHYQAL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 3-amino-4-hydroxy-5-methylbenzoate |
| InChIKey | JXUSYVMEOHYQAL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)N)C(=O)OC |
Computed by PubChem (NCBI)