cas: 61-76-7 — see every product listed under this CAS number, including other names
(R)-Phenylephrine Hydrochloride, >98.0%(HPLC)(T) (CAS 61-76-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0398-5G |
| cas | 61-76-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 172.43 Pln | |
| TCI | 25g | 536.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 61-76-7) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)