cas: 61-76-7 — see every product listed under this CAS number, including other names
L(-)-Phenylephrine hydrochloride, 99% (CAS 61-76-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 207240100 |
| cas | 61-76-7 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 458.81 Pln | |
| Thermo Scientific (Acros) | 25g | 810.71 Pln | |
| Thermo Scientific (Acros) | 100g | 2267.32 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 61-76-7) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)