cas: 61-76-7 — see every product listed under this CAS number, including other names
(R)-3-(1-Hydroxy-2-(methylamino)ethyl)phenol hydrochloride, ≥99%, ≥99% (CAS 61-76-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAS0-1g |
| cas | 61-76-7 |
| size | 1g |
| availability | 1300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 458.00 Pln | |
| Chemat | 100g | 678.80 Pln |
| purity | ≥99% |
|---|---|
| delivery time | 3 weeks |
3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 61-76-7) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)