cas: 1187932-69-9 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-(iodomethyl)pyrrolidine-1-carboxylate 98% (CAS 1187932-69-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A537773-10g |
| cas | 1187932-69-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 7924.25 Pln | |
| Ambeed | 50mg | 175.69 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 1215.88 Pln | |
| Ambeed | 5g | 4442.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A537773 |
Tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 1187932-69-9) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-QMMMGPOBSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CI |
Computed by PubChem (NCBI)