cas: 1416450-63-9 — see every product listed under this CAS number, including other names
(R)-tert-Butyl pyrrolidin-3-ylcarbamate hydrochloride 97% (CAS 1416450-63-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136890-1g |
| cas | 1416450-63-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 782.00 Pln | |
| Ambeed | 100g | 2356.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A136890 |
Tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate;hydrochloride (CAS 1416450-63-9) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: UYIZWZJKNFDMPB-OGFXRTJISA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | UYIZWZJKNFDMPB-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC1.Cl |
Computed by PubChem (NCBI)