CAS 2095192-25-7 appears in our catalog under these names: tert-Butyl rac-[(1s,2s)-2-aminocyclobutyl]carbamate hydrochloride, 95%, tert-Butyl rac-((1S,2S)-2-aminocyclobutyl)carbamate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[(1S,2S)-2-aminocyclobutyl]carbamate;hydrochloride (CAS 2095192-25-7) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-aminocyclobutyl]carbamate;hydrochloride. InChIKey: LKVSVLOXMVTZHJ-LEUCUCNGSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-aminocyclobutyl]carbamate;hydrochloride |
| InChIKey | LKVSVLOXMVTZHJ-LEUCUCNGSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H]1N.Cl |
Computed by PubChem (NCBI)