Products 1049721-59-6

CAS 1049721-59-6 is the registry number for N-Alloc-1,5-pentanediamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Prop-2-enyl N-(5-aminopentyl)carbamate;hydrochloride (CAS 1049721-59-6) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: prop-2-enyl N-(5-aminopentyl)carbamate;hydrochloride. InChIKey: RXDHRWKGTMXRAD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19ClN2O2
Molecular weight222.71 g/mol
IUPAC nameprop-2-enyl N-(5-aminopentyl)carbamate;hydrochloride
InChIKeyRXDHRWKGTMXRAD-UHFFFAOYSA-N
SMILESC=CCOC(=O)NCCCCCN.Cl

Computed by PubChem (NCBI)