Products 1416450-61-7

CAS 1416450-61-7 is the registry number for (S)-3-(Boc-amino)pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3S)-pyrrolidin-3-yl]carbamate;hydrochloride (CAS 1416450-61-7) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(3S)-pyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: UYIZWZJKNFDMPB-FJXQXJEOSA-N.

Identity
Molecular formulaC9H19ClN2O2
Molecular weight222.71 g/mol
IUPAC nametert-butyl N-[(3S)-pyrrolidin-3-yl]carbamate;hydrochloride
InChIKeyUYIZWZJKNFDMPB-FJXQXJEOSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CCNC1.Cl

Computed by PubChem (NCBI)