CAS 2173637-08-4 appears in our catalog under these names: tert-Butyl n-[trans-2-methylazetidin-3-yl]carbamate hydrochloride, 95%, tert-Butyl ((2R,3S)-2-methylazetidin-3-yl)carbamate hydrochloride 95%, tert-butyl ((2R,3S)-2-methylazetidin-3-yl)carbamate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg, 500mg.
Tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride (CAS 2173637-08-4) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-HHQFNNIRSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride |
| InChIKey | QEGLJGQQFDDFJO-HHQFNNIRSA-N |
| SMILES | C[C@@H]1[C@H](CN1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)