CAS 40648-92-8 appears in our catalog under these names: (S,S)-(-)-Bis(a-methylbenzyl)amine Hcl, (S,S)-(-)-Bis(alpha-methylbenzyl)amine Hydrochloride, >98.0%(HPLC)(T), (S)-Bis((S)-1-phenylethyl)amine hydrochloride, 98%, 98%, (S,S)-(-)-BIS(ALPHA-METHYLBENZYL)AMINE HCL, 98%, (S)-Bis((S)-1-phenylethyl)amine hydrochloride, 98%. Offered by: Biosynth, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,1kg, 5g, 100g, 250mg, 1g, 2g, 25g, 10g.
(1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine;hydrochloride (CAS 40648-92-8) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: (1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine;hydrochloride. InChIKey: ZBQCLJZOKDRAOW-IODNYQNNSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | (1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine;hydrochloride |
| InChIKey | ZBQCLJZOKDRAOW-IODNYQNNSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N[C@@H](C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)