CAS 190581-71-6 appears in our catalog under these names: (R)–Lanicemine, (R)-Lanicemine. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 10 mg, 10mM/1mL, 100 mg.
(1R)-1-phenyl-2-pyridin-2-ylethanamine (CAS 190581-71-6) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: (1R)-1-phenyl-2-pyridin-2-ylethanamine. InChIKey: FWUQWDCOOWEXRY-CYBMUJFWSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (1R)-1-phenyl-2-pyridin-2-ylethanamine |
| InChIKey | FWUQWDCOOWEXRY-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CC2=CC=CC=N2)N |
Computed by PubChem (NCBI)