CAS 153322-05-5 appears in our catalog under these names: Lanicemine, Lanicemine, >95% (HPLC), Lanicemine, 99.0%. Offered by: GLPBio, TRC, TargetMol, MedChemExpress. Available pack sizes: 5mg, 50mg, 10mg, 25mg, Get quote.
(1S)-1-phenyl-2-pyridin-2-ylethanamine (CAS 153322-05-5) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: (1S)-1-phenyl-2-pyridin-2-ylethanamine. InChIKey: FWUQWDCOOWEXRY-ZDUSSCGKSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (1S)-1-phenyl-2-pyridin-2-ylethanamine |
| InChIKey | FWUQWDCOOWEXRY-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC2=CC=CC=N2)N |
Computed by PubChem (NCBI)