cas: 20445-33-4 — see every product listed under this CAS number, including other names
(S)-(+)-a-Methoxy-a-trifluoromethylphenylacetyl chloride (CAS 20445-33-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009427-5G |
| cas | 20445-33-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 10093.34 Pln | |
| Fluorochem | 50mg | 513.38 Pln | |
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 1g | 2590.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride (CAS 20445-33-4) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride. InChIKey: PAORVUMOXXAMPL-SECBINFHSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| InChIKey | PAORVUMOXXAMPL-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)