cas: 20445-33-4 — see every product listed under this CAS number, including other names
(S)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoyl chloride 97% (CAS 20445-33-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A343152-100mg |
| cas | 20445-33-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 598.44 Pln | |
| Ambeed | 250mg | 1126.88 Pln | |
| Ambeed | 1g | 2873.50 Pln | |
| Ambeed | 5g | 10071.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A343152 |
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride (CAS 20445-33-4) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride. InChIKey: PAORVUMOXXAMPL-SECBINFHSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| InChIKey | PAORVUMOXXAMPL-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)