cas: 106092-09-5 — see every product listed under this CAS number, including other names
(S)-(-)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole, 98%, 98% (CAS 106092-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CMB-1g |
| cas | 106092-09-5 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-09-5) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-BYPYZUCNSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-BYPYZUCNSA-N |
| SMILES | C1CC2=C(C[C@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)