cas: 106092-09-5 — see every product listed under this CAS number, including other names
Pramipexole impurity 9, 99.95% (CAS 106092-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g, 25 g, 10 g, 50 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W003372-100 g |
| cas | 106092-09-5 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 695.86 Pln | |
| MedChemExpress | 500 g | 2451.29 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 50 g | 524.03 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
(6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-09-5) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-BYPYZUCNSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-BYPYZUCNSA-N |
| SMILES | C1CC2=C(C[C@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)