cas: 106092-09-5 — see every product listed under this CAS number, including other names
(S)-4,5,6,7-Tetrahydro-benzothiazole-2,6-diamine, 97% (CAS 106092-09-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040277-5G |
| cas | 106092-09-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 466.52 Pln | |
| Fluorochem | 500g | 2049.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-09-5) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-BYPYZUCNSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-BYPYZUCNSA-N |
| SMILES | C1CC2=C(C[C@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)