cas: 683276-63-3 — see every product listed under this CAS number, including other names
(S)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzenesulfonate, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 683276-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DII4-250mg |
| cas | 683276-63-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2906.00 Pln | |
| Chemat | 25g | 9333.20 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
[(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate (CAS 683276-63-3) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate. InChIKey: NXRMOVSGORLBCA-JTQLQIEISA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate |
| InChIKey | NXRMOVSGORLBCA-JTQLQIEISA-N |
| SMILES | C[C@]1(CO1)COS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)