cas: 844647-37-6 — see every product listed under this CAS number, including other names
(S)-1-(2,4-Difluorophenyl)ethanamine hydrochloride, 95% (CAS 844647-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078538-250MG |
| cas | 844647-37-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1643.19 Pln | |
| Fluorochem | 25g | 7630.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2,4-difluorophenyl)ethanamine;hydrochloride (CAS 844647-37-6) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1S)-1-(2,4-difluorophenyl)ethanamine;hydrochloride. InChIKey: BWIGKZOWBCNPTI-JEDNCBNOSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1S)-1-(2,4-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BWIGKZOWBCNPTI-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)