(S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%
cas: 1391431-90-5 — see every product listed under this CAS number, including other names
(S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95% (CAS 1391431-90-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A148844-100mg |
| cas | 1391431-90-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| BLDpharm | 100mg | 392.11 Pln | |
| BLDpharm | 250mg | 686.45 Pln | |
| BLDpharm | 1g | 1780.51 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 100mg | 497.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride (CAS 1391431-90-5) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: RXYPROYXZWFRHT-FVGYRXGTSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | RXYPROYXZWFRHT-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, (S)-1-(2,5-Difluorophenyl)propan-1-amine HCl, (1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride, (1S)-1-(2,5-difluorophenyl)propan-1-amine hydrochloride, s10040, (S)-1-(2,5-Difluorophenyl)-1-propanamine Hydrochloride, (S)-1-(2,5-Difluorophenyl)propan-1-aminehydrochloride, (S)-1-(25-Difluorophenyl)propan-1-amine hydrochloride, (1S)-1-(2,5-Difluorophenyl)propan-1-amine--hydrogen chloride (1/1)