CAS 1333577-52-8 appears in our catalog under these names: 1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%, 1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 1-(2,5-Difluorophenyl)propan-1-amine hydrochloride 95%, 1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 100mg, 5g.
1-(2,5-difluorophenyl)propan-1-amine;hydrochloride (CAS 1333577-52-8) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 1-(2,5-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: RXYPROYXZWFRHT-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | RXYPROYXZWFRHT-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)