Products 1803562-69-7
CAS 1803562-69-7 appears in our catalog under these names: 2,2-Difluoro-2-(3-methylphenyl)ethan-1-amine hydrochloride, 95%, 2,2-Difluoro-2-(3-methylphenyl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
2,2-difluoro-2-(3-methylphenyl)ethanamine;hydrochloride (CAS 1803562-69-7) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 2,2-difluoro-2-(3-methylphenyl)ethanamine;hydrochloride. InChIKey: YRJJHSDMYCXBJE-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | YRJJHSDMYCXBJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)