CAS 1391431-90-5 appears in our catalog under these names: (S)–1–(2,5–Difluorophenyl)propan–1–amine hydrochloride, (S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride 95%, (S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%, 95%, (S)-1-(2,5-Difluorophenyl)propan-1-amine hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
(1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride (CAS 1391431-90-5) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: RXYPROYXZWFRHT-FVGYRXGTSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1S)-1-(2,5-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | RXYPROYXZWFRHT-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)