CAS 1253792-95-8 appears in our catalog under these names: (R)-1-(2,4-Difluorophenyl)propan-1-amine hydrochloride, 95%, (R)–1–(2,4–Difluorophenyl)propan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride (CAS 1253792-95-8) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1R)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: YXYGIKPAUSGSLO-SBSPUUFOSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1R)-1-(2,4-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | YXYGIKPAUSGSLO-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)