(S)-1-(2,6-Difluorophenyl)ethanamine hydrochloride, 97%
cas: 1309598-68-2 — see every product listed under this CAS number, including other names
(S)-1-(2,6-Difluorophenyl)ethanamine hydrochloride, 97% (CAS 1309598-68-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A492686-100mg |
| cas | 1309598-68-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 859.88 Pln | |
| Ambeed | 5g | 2918.00 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2766.80 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 919.70 Pln | |
| BLDpharm | 5g | 3141.14 Pln | |
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 10g | 5896.90 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(2,6-difluorophenyl)ethanamine;hydrochloride (CAS 1309598-68-2) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1S)-1-(2,6-difluorophenyl)ethanamine;hydrochloride. InChIKey: PEZUBPXSPPADIL-JEDNCBNOSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1S)-1-(2,6-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | PEZUBPXSPPADIL-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1S)-1-(2,6-Difluorophenyl)ethylamine hydrochloride, (S)-1-(2,6-DIFLUOROPHENYL)ETHANAMINE hydrochloride, (S)-1-(2,6-DIFLUOROPHENYL)ETHANAMINE-HCl, (1S)-1-(2,6-difluorophenyl)ethanamine;hydrochloride, (S)-1-(2,6-difluorophenyl)ethan-1-amine hydrochloride, (1S)-1-(2,6-difluorophenyl)ethan-1-amine hydrochloride, (S)-1-(2,6-Difluorophenyl)ethylamine hydrochloride, (S)-1-(2,6-Difluorophenyl)ethanamine HCl, (S)-1-(2,6-Difluorophenyl)ethanaminehydrochloride, (1S)-1-(2,6-Difluorophenyl)ethan-1-amine--hydrogen chloride (1/1)