cas: 1624261-91-1 — see every product listed under this CAS number, including other names
(S)-1-(2-BROMO-4-FLUOROPHENYL)ETHANAMINE HCL, 98% (CAS 1624261-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386207-100MG |
| cas | 1624261-91-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 763.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride (CAS 1624261-91-1) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1S)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MMBXNJVKDHDORR-JEDNCBNOSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1S)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MMBXNJVKDHDORR-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)F)Br)N.Cl |
Computed by PubChem (NCBI)