CAS 1305712-20-2 appears in our catalog under these names: (1R)-1-(3-Bromo-4-fluorophenyl)ethan-1-amine hydrochloride, 98%, (1R)-1-(3-Bromo-4-fluorophenyl)ethan-1-amine hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 50mg, 500mg.
(1R)-1-(3-bromo-4-fluorophenyl)ethanamine;hydrochloride (CAS 1305712-20-2) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1R)-1-(3-bromo-4-fluorophenyl)ethanamine;hydrochloride. InChIKey: XPCQHDRARULRNJ-NUBCRITNSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1R)-1-(3-bromo-4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | XPCQHDRARULRNJ-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)F)Br)N.Cl |
Computed by PubChem (NCBI)