(S)-1-(3,5-Difluorophenyl)propan-1-amine hydrochloride, 95%
cas: 1212812-49-1 — see every product listed under this CAS number, including other names
(S)-1-(3,5-Difluorophenyl)propan-1-amine hydrochloride, 95% (CAS 1212812-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A514385-100mg |
| cas | 1212812-49-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 815.38 Pln | |
| Ambeed | 250mg | 1165.81 Pln | |
| Ambeed | 1g | 2834.56 Pln | |
| Chemat | 50mg | 693.20 Pln | |
| Chemat | 100mg | 933.20 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| BLDpharm | 50mg | 719.77 Pln | |
| BLDpharm | 100mg | 864.16 Pln | |
| BLDpharm | 250mg | 1252.92 Pln | |
| BLDpharm | 1g | 3046.73 Pln | |
| Fluorochem | 50mg | 1278.73 Pln | |
| Fluorochem | 100mg | 1716.08 Pln | |
| Fluorochem | 250mg | 2543.91 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(3,5-difluorophenyl)propan-1-amine;hydrochloride (CAS 1212812-49-1) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: LGEMCPLXQQXMSU-FVGYRXGTSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | LGEMCPLXQQXMSU-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC(=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-1-(3,5-DIFLUOROPHENYL)PROPAN-1-AMINE hydrochloride, (S)-1-(3,5-DIFLUOROPHENYL)PROPAN-1-AMINE-HCl, (s)-1-(3,5-difluorophenyl)propan-1-amine hcl, (1S)-1-(3,5-Difluorophenyl)propylamine hydrochloride, (1S)-1-(3,5-difluorophenyl)propan-1-amine;hydrochloride, (1S)-1-(3,5-difluorophenyl)propan-1-amine,hydrochloride, (S)-1-(3,5-Difluorophenyl)propan-1-aminehydrochloride, (1S)-1-(3,5-difluorophenyl)propan-1-amine hydrochloride, (1S)-1-(3,5-Difluorophenyl)propan-1-amine--hydrogen chloride (1/1)