cas: 878408-46-9 — see every product listed under this CAS number, including other names
(S)-1-(3-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride 95+% (CAS 878408-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A781085-100mg |
| cas | 878408-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1738.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A781085 |
(1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 878408-46-9) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-FJXQXJEOSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)