CAS 842169-71-5 appears in our catalog under these names: 1-(3-Bromo-phenyl)-2,2,2-trifluoro-ethylamine hydrochloride, 95%, 1-(3-Bromo-phenyl)-2,2,2-trifluoro-ethylamine hydrochloride, 98%, 1–(3–Bromo–phenyl)–2,2,2–trifluoro–ethylamine hydrochloride, 1-(3-Bromo-phenyl)-2,2,2-trifluoro-ethylamine hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg, 500mg.
1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-71-5) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)