CAS 842169-72-6 appears in our catalog under these names: 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 98%, 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 98%, 98%, 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg, 100mg, 500mg.
1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-72-6) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: XESDERGPILUSRV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | XESDERGPILUSRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)