cas: 878408-46-9 — see every product listed under this CAS number, including other names
(S)-1-(3-BROMOPHENYL)-2,2,2-TRIFLUOROETHAN-1-AMINE HCL, 98% (CAS 878408-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532024-100MG |
| cas | 878408-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 1g | 2231.52 Pln | |
| Fluorochem | 5g | 7760.83 Pln | |
| Fluorochem | 10g | 13461.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 878408-46-9) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-FJXQXJEOSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)