cas: 951247-75-9 — see every product listed under this CAS number, including other names
(S)-1-(4-(Trifluoromethoxy)phenyl)ethanamine, 95%, 95% (CAS 951247-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116T75-100mg |
| cas | 951247-75-9 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 218.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine (CAS 951247-75-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine. InChIKey: VTLIABOHZPSHRN-LURJTMIESA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine |
| InChIKey | VTLIABOHZPSHRN-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)