cas: 84499-77-4 — see every product listed under this CAS number, including other names
(S)-1-(4-Bromophenyl)ethanamine Hydrochloride, 97%, 97% (CAS 84499-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4LW-100mg |
| cas | 84499-77-4 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 424.40 Pln | |
| Chemat | 10g | 765.20 Pln | |
| Chemat | 25g | 1043.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 84499-77-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)