cas: 84499-77-4 — see every product listed under this CAS number, including other names
(S)-1-(4-Bromophenyl)ethanamine hydrochloride 97% (CAS 84499-77-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A368353-1g |
| cas | 84499-77-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 993.38 Pln | |
| Ambeed | 25g | 1349.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A368353 |
(1S)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 84499-77-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)