cas: 1419073-74-7 — see every product listed under this CAS number, including other names
(S)-1-(4-fluorophenyl)ethan-1-amine hydrochloride 98% (CAS 1419073-74-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750540-5g |
| cas | 1419073-74-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 537.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750540 |
(1S)-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 1419073-74-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBYCTXPTBWSAMJ-RGMNGODLSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBYCTXPTBWSAMJ-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)