cas: 1419073-74-7 — see every product listed under this CAS number, including other names
(S)-1-(4-fluorophenyl)ethan-1-amine hydrochloride, 98%, 98% (CAS 1419073-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C6B-100mg |
| cas | 1419073-74-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 405.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 1419073-74-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBYCTXPTBWSAMJ-RGMNGODLSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBYCTXPTBWSAMJ-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)