cas: 198646-60-5 — see every product listed under this CAS number, including other names
(S)-1-(tert-Butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid, 97%, 97% (CAS 198646-60-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BNV-500g |
| cas | 198646-60-5 |
| size | 500g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 8246.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 544.40 Pln | |
| Chemat | 50g | 990.80 Pln | |
| Chemat | 100g | 1888.40 Pln | |
| Chemat | 250g | 4264.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid (CAS 198646-60-5) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid. InChIKey: GPBCBXYUAJQMQM-QMMMGPOBSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid |
| InChIKey | GPBCBXYUAJQMQM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)