cas: 82950-72-9 — see every product listed under this CAS number, including other names
(S)-1-Acetylindoline-2-carboxylic acid, 97% (CAS 82950-72-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A756143-10g |
| cas | 82950-72-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19704.16 Pln | |
| AmBeed | 5g | 13272.28 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid (CAS 82950-72-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid. InChIKey: OGMIMMRKTFZDKW-JTQLQIEISA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2S)-1-acetyl-2,3-dihydroindole-2-carboxylic acid |
| InChIKey | OGMIMMRKTFZDKW-JTQLQIEISA-N |
| SMILES | CC(=O)N1[C@@H](CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)