cas: 1212293-24-7 — see every product listed under this CAS number, including other names
(S)-1-Benzylpyrrolidine-3-carboxylic acid hydrochloride, 97% (CAS 1212293-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A848377-100mg |
| cas | 1212293-24-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 610.33 Pln | |
| AmBeed | 5g | 8363.74 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1212293-24-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: (3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: LFWISXSUMOTUQQ-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | (3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | LFWISXSUMOTUQQ-MERQFXBCSA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)