CAS 1212293-24-7 appears in our catalog under these names: (S)-1-N-Benzyl-beta-proline hydrochloride, 95%, (S)-1-Benzylpyrrolidine-3-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
(3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1212293-24-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: (3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: LFWISXSUMOTUQQ-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | (3S)-1-benzylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | LFWISXSUMOTUQQ-MERQFXBCSA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)