cas: 93423-88-2 — see every product listed under this CAS number, including other names
(S)-1-Ethyl 2-methyl pyrrolidine-1,2-dicarboxylate (CAS 93423-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338205-250MG |
| cas | 93423-88-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1257.91 Pln | |
| Fluorochem | 5g | 3887.19 Pln |
| delivery time | 3-4 weeks |
|---|
1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate (CAS 93423-88-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: YCWGTZNCRJOYQK-ZETCQYMHSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate |
| InChIKey | YCWGTZNCRJOYQK-ZETCQYMHSA-N |
| SMILES | CCOC(=O)N1CCC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)